methyl 4-n-octyloxybenzoate structure
|
Common Name | methyl 4-n-octyloxybenzoate | ||
|---|---|---|---|---|
| CAS Number | 62435-37-4 | Molecular Weight | 264.36000 | |
| Density | 0.99 g/cm3 | Boiling Point | 362.5ºC at 760 mmHg | |
| Molecular Formula | C16H24O3 | Melting Point | 35-37ºC | |
| MSDS | N/A | Flash Point | 151.4ºC | |
| Name | methyl 4-n-octyloxybenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 0.99 g/cm3 |
|---|---|
| Boiling Point | 362.5ºC at 760 mmHg |
| Melting Point | 35-37ºC |
| Molecular Formula | C16H24O3 |
| Molecular Weight | 264.36000 |
| Flash Point | 151.4ºC |
| Exact Mass | 264.17300 |
| PSA | 35.53000 |
| LogP | 4.21250 |
| Index of Refraction | 1.489 |
| InChIKey | JCVLYBQFVTYGKT-UHFFFAOYSA-N |
| SMILES | CCCCCCCCOc1ccc(C(=O)OC)cc1 |
| Precursor 7 | |
|---|---|
| DownStream 9 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| methyl 4-octoxybenzoate |
| MFCD00070805 |