p-Octyloxybenzoic Acid structure
|
Common Name | p-Octyloxybenzoic Acid | ||
|---|---|---|---|---|
| CAS Number | 2493-84-7 | Molecular Weight | 250.333 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 375.9±15.0 °C at 760 mmHg | |
| Molecular Formula | C15H22O3 | Melting Point | 101-105 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 133.1±13.9 °C | |
| Name | 4-octoxybenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 375.9±15.0 °C at 760 mmHg |
| Melting Point | 101-105 °C(lit.) |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.333 |
| Flash Point | 133.1±13.9 °C |
| Exact Mass | 250.156891 |
| PSA | 46.53000 |
| LogP | 5.68 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.510 |
| InChIKey | IALWCYFULVHLEC-UHFFFAOYSA-N |
| SMILES | CCCCCCCCOc1ccc(C(=O)O)cc1 |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Safety Phrases | S24/25 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2918990090 |
| Precursor 10 | |
|---|---|
| DownStream 5 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|
Aldrichimica Acta 23 , 23, (1990)
|
| p-Octyloxybenzoic Acid |
| Benzoic acid,4-(octyloxy) |
| Benzoic acid, 4-(octyloxy)- |
| 4-n-octyloxybenzoic acid |
| P-N-OCTYLOXYBENZOIC ACID |
| 4-Octyloxybenzoic acid |
| 4-(Octyloxy)benzoic acid |
| p-Octoxybenzoic acid |
| MFCD00013993 |