4-(Octyloxy)benzenecarbothioic acid S-(4-pentylphenyl) ester
Modify Date: 2025-09-26 12:29:11
4-(Octyloxy)benzenecarbothioic acid S-(4-pentylphenyl) ester structure
|
Common Name | 4-(Octyloxy)benzenecarbothioic acid S-(4-pentylphenyl) ester | ||
|---|---|---|---|---|
| CAS Number | 61519-05-9 | Molecular Weight | 412.62800 | |
| Density | 1.047g/cm3 | Boiling Point | 521.676ºC at 760 mmHg | |
| Molecular Formula | C26H36O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 244.032ºC | |
| Name | S-(4-pentylphenyl) 4-octoxybenzenecarbothioate |
|---|
| Density | 1.047g/cm3 |
|---|---|
| Boiling Point | 521.676ºC at 760 mmHg |
| Molecular Formula | C26H36O2S |
| Molecular Weight | 412.62800 |
| Flash Point | 244.032ºC |
| Exact Mass | 412.24400 |
| PSA | 51.60000 |
| LogP | 8.09110 |
| Index of Refraction | 1.553 |
| InChIKey | LTYZTPZHKWYMOE-UHFFFAOYSA-N |
| SMILES | CCCCCCCCOc1ccc(C(=O)Sc2ccc(CCCCC)cc2)cc1 |
| HS Code | 2930909090 |
|---|
|
~%
4-(Octyloxy)ben... CAS#:61519-05-9 |
| Literature: Chrusciel, J.; Wrobel, S.; Kresse, H.; Urban, S.; Otowski, W. Molecular Crystals and Liquid Crystals (1969-1991), 1985 , vol. 127, p. 57 - 66 |
| HS Code | 2930909090 |
|---|---|
| Summary | 2930909090. other organo-sulphur compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |