Acetophenazine
Modify Date: 2025-08-25 10:50:10
Acetophenazine structure
|
Common Name | Acetophenazine | ||
|---|---|---|---|---|
| CAS Number | 2751-68-0 | Molecular Weight | 411.56000 | |
| Density | 1.203g/cm3 | Boiling Point | 608.7ºC at 760mmHg | |
| Molecular Formula | C23H29N3O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 321.9ºC | |
Use of AcetophenazineAcetophenazine, a phenothiazine derivative, is an antipsychotic agent. Acetophenazine primarily blocks dopamine D2 receptors in the brain. Acetophenazine can be used for researching psychotic disorders such as schizophrenia and anxious depression[1][2]. |
| Name | acetophenazine |
|---|---|
| Synonym | More Synonyms |
| Description | Acetophenazine, a phenothiazine derivative, is an antipsychotic agent. Acetophenazine primarily blocks dopamine D2 receptors in the brain. Acetophenazine can be used for researching psychotic disorders such as schizophrenia and anxious depression[1][2]. |
|---|---|
| Related Catalog | |
| Target |
D2 Receptor |
| In Vivo | Acetophenazine (2.4 mg/kg; i.h.; single dosage) significantly prolongs the time lapse from the first fight to submission and the actual fighting time to submission in mice[3]. Animal Model: C57BL mice (10-12 weeks)[3] Dosage: 2.4 mg/kg Administration: i.h.; single dosage Result: Significantly prolonged the time lapse from the first fight to submission and the actual fighting time to submission. |
| References |
| Density | 1.203g/cm3 |
|---|---|
| Boiling Point | 608.7ºC at 760mmHg |
| Molecular Formula | C23H29N3O2S |
| Molecular Weight | 411.56000 |
| Flash Point | 321.9ºC |
| Exact Mass | 411.19800 |
| PSA | 72.32000 |
| LogP | 3.43270 |
| Vapour Pressure | 7.83E-16mmHg at 25°C |
| Index of Refraction | 1.615 |
| InChIKey | WNTYBHLDCKXEOT-UHFFFAOYSA-N |
| SMILES | CC(=O)c1ccc2c(c1)N(CCCN1CCN(CCO)CC1)c1ccccc1S2 |
| Hazard Codes | Xn |
|---|
| 1-(10-{3-[4-(2-hydroxy-ethyl)-piperazino]-propyl}-phenothiazin-2-yl)-ethanone |
| Acetophenazinum [INN-Latin] |
| 1-(10-{3-[4-(2-Hydroxy-aethyl)-piperazino]-propyl}-phenothiazin-2-yl)-aethanon |
| 10-<3-(1-(2-Hydroxy-aethyl)-piperazinyl-(4))-propyl>-2-acetyl-phenothiazin |
| 2-acetyl-10-(-3-[4-(2-hydroxyethyl)-1-piperazinyl]propyl)phenothiazine |
| Acetophenazinum |
| 1-[10-[3-[4-(2-hydroxyethyl)piperazin-1-yl]propyl]phenothiazin-2-yl]ethanone |
| Acetophenazina [INN-Spanish] |
| ACETOPHENAZINE |
| Acephenazinum |
| Tindal |
| 1-(10-{3-[4-(2-hydroxy-ethyl)-piperazin-1-yl]-propyl}-10H-phenothiazin-2-yl)-ethanone |
| Acetophenazine [INN] |