GRK6-IN-2
Modify Date: 2025-10-15 09:43:43
GRK6-IN-2 structure
|
Common Name | GRK6-IN-2 | ||
|---|---|---|---|---|
| CAS Number | 2677786-27-3 | Molecular Weight | 376.43 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H21FN6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of GRK6-IN-2GRK6-IN-2 (compound 10a) is a potent inhibitor of G protein-coupled receptor kinase 6 (GRK6) with an IC50 of 120 nM. GRK6 is a critical kinase required for the survival of multiple myeloma (MM) cells. GRK6-IN-2 has the potential for the research of multiple myeloma[1]. |
| Name | GRK6-IN-2 |
|---|
| Description | GRK6-IN-2 (compound 10a) is a potent inhibitor of G protein-coupled receptor kinase 6 (GRK6) with an IC50 of 120 nM. GRK6 is a critical kinase required for the survival of multiple myeloma (MM) cells. GRK6-IN-2 has the potential for the research of multiple myeloma[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C21H21FN6 |
|---|---|
| Molecular Weight | 376.43 |
| InChIKey | QIKJAWWGNVSEHB-ZDUSSCGKSA-N |
| SMILES | CCc1cc(Nc2nc(NC(C)c3ccc(F)cc3)nc3ccccc23)n[nH]1 |