NEP-IN-2
Modify Date: 2025-08-26 18:01:40
NEP-IN-2 structure
|
Common Name | NEP-IN-2 | ||
|---|---|---|---|---|
| CAS Number | 145775-14-0 | Molecular Weight | 341.48900 | |
| Density | 1.204g/cm3 | Boiling Point | 603ºC at 760 mmHg | |
| Molecular Formula | C16H23NO3S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 318.5ºC | |
Use of NEP-IN-2NEP-IN-2 is an inhibitor of neutral endopeptidase, used in the research of proliferation in atherosclerosis, restenosis. |
| Name | N-[2-(2-Methylbenzyl)-3-sulfanylpropanoyl]-L-methionine |
|---|---|
| Synonym | More Synonyms |
| Description | NEP-IN-2 is an inhibitor of neutral endopeptidase, used in the research of proliferation in atherosclerosis, restenosis. |
|---|---|
| Related Catalog | |
| Target |
Neutral endopeptidase[1] |
| In Vitro | NEP-IN-2 is an inhibitor of neutral endopeptidase (NEP), used in the research of proliferation in atherosclerosis, restenosis induced by angioplasty or vascular reconstructive surgery, glomerulonephritis, glomerulosclerosis or other diseases involving vascular cell proliferation[1]. |
| References |
| Density | 1.204g/cm3 |
|---|---|
| Boiling Point | 603ºC at 760 mmHg |
| Molecular Formula | C16H23NO3S2 |
| Molecular Weight | 341.48900 |
| Flash Point | 318.5ºC |
| Exact Mass | 341.11200 |
| PSA | 133.99000 |
| LogP | 3.24630 |
| Vapour Pressure | 2.16E-15mmHg at 25°C |
| Index of Refraction | 1.578 |
| InChIKey | FGXXIAHRYGHABD-KZUDCZAMSA-N |
| SMILES | CSCCC(NC(=O)C(CS)Cc1ccccc1C)C(=O)O |
| FORMATEROL FUMATATE |
| ForMaterol FuMarate |
| N-[2-mercaptomethyl-3-(2-methylphenyl)propioyl]-methionine |
| Aformoterol |
| Eformoterol fumarate |
| FarMeterol |
| (R,R)-formoterol fumarate |
| N-[2-hydroxy-5-[(1R)-1-hydroxy-2-[[(1R)-(4-methoxyphenyl)-1-methylethyl]-amino]ethyl]phenyl]formamide |
| N-[2-mercaptomethyl-3-(2-methylphenyl)propionyl]-methionine |
| NEP-IN-2 |