O-Acetylgalanthamine structure
|
Common Name | O-Acetylgalanthamine | ||
|---|---|---|---|---|
| CAS Number | 25650-83-3 | Molecular Weight | 329.39 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H23NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of O-AcetylgalanthamineO-Acetylgalanthamine, a acetylated alkaloid, is a natural product that can be isolated from Narcissus pseudonarcissus[1]. |
| Name | O-acetylgalanthamine |
|---|---|
| Synonym | More Synonyms |
| Description | O-Acetylgalanthamine, a acetylated alkaloid, is a natural product that can be isolated from Narcissus pseudonarcissus[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C19H23NO4 |
|---|---|
| Molecular Weight | 329.39 |
| Exact Mass | 329.16300 |
| PSA | 48.00000 |
| LogP | 2.35900 |
| InChIKey | ZTWNMOVEDXUICV-QOKNQOGYSA-N |
| SMILES | COc1ccc2c3c1OC1CC(OC(C)=O)C=CC31CCN(C)C2 |
| Hazard Codes | Xi |
|---|
| galanthamine acetate |
| 3β-acetoxy-6-methoxy-10-methyl-galantham-1-ene |
| 3β-Acetoxy-6-methoxy-10-methyl-galantham-1-en |
| SPH-1313 |