Bempedoic acid-d4 structure
|
Common Name | Bempedoic acid-d4 | ||
|---|---|---|---|---|
| CAS Number | 2408131-70-2 | Molecular Weight | 348.51 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H32D4O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Bempedoic acid-d4Bempedoic acid-d4 is the deuterium labeled Bempedoic acid. Bempedoic acid (ETC-1002) is an ATP-citrate lyase (ACL) inhibitor. Bempedoic acid (ETC-1002) activates AMPK[1][2]. |
| Name | Bempedoic acid-d4 |
|---|
| Description | Bempedoic acid-d4 is the deuterium labeled Bempedoic acid. Bempedoic acid (ETC-1002) is an ATP-citrate lyase (ACL) inhibitor. Bempedoic acid (ETC-1002) activates AMPK[1][2]. |
|---|---|
| Related Catalog | |
| In Vitro | Stable heavy isotopes of hydrogen, carbon, and other elements have been incorporated into drug molecules, largely as tracers for quantitation during the drug development process. Deuteration has gained attention because of its potential to affect the pharmacokinetic and metabolic profiles of drugs[3]. |
| References |
| Molecular Formula | C19H32D4O5 |
|---|---|
| Molecular Weight | 348.51 |
| InChIKey | HYHMLYSLQUKXKP-AREBVXNXSA-N |
| SMILES | CC(C)(CCCCCC(O)CCCCCC(C)(C)C(=O)O)C(=O)O |