Fmoc-N-PEG7-acid
Modify Date: 2025-08-23 11:12:42
Fmoc-N-PEG7-acid structure
|
Common Name | Fmoc-N-PEG7-acid | ||
|---|---|---|---|---|
| CAS Number | 1863885-74-8 | Molecular Weight | 619.700 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 758.0±60.0 °C at 760 mmHg | |
| Molecular Formula | C32H45NO11 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 412.2±32.9 °C | |
Use of Fmoc-N-PEG7-acidFmoc-N-amido-PEG7-acid is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | 1-(9H-Fluoren-9-yl)-3-oxo-2,7,10,13,16,19,22,25-octaoxa-4-azaoctacosan-28-oic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Fmoc-N-amido-PEG7-acid is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 758.0±60.0 °C at 760 mmHg |
| Molecular Formula | C32H45NO11 |
| Molecular Weight | 619.700 |
| Flash Point | 412.2±32.9 °C |
| Exact Mass | 619.299255 |
| LogP | 1.23 |
| Vapour Pressure | 0.0±2.7 mmHg at 25°C |
| Index of Refraction | 1.534 |
| InChIKey | QTWMNLIXRWCJSM-UHFFFAOYSA-N |
| SMILES | O=C(O)CCOCCOCCOCCOCCOCCOCCOCCNC(=O)OCC1c2ccccc2-c2ccccc21 |
| 1-(9H-Fluoren-9-yl)-3-oxo-2,7,10,13,16,19,22,25-octaoxa-4-azaoctacosan-28-oic acid |
| 2,7,10,13,16,19,22,25-Octaoxa-4-azaoctacosan-28-oic acid, 1-(9H-fluoren-9-yl)-3-oxo- |