Fmoc-PEG2-NHS ester
Modify Date: 2025-08-27 13:10:33
Fmoc-PEG2-NHS ester structure
|
Common Name | Fmoc-PEG2-NHS ester | ||
|---|---|---|---|---|
| CAS Number | 1807534-85-5 | Molecular Weight | 496.51 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C26H28N2O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Fmoc-PEG2-NHS esterFmoc-PEG2-CH2CH2-NHS ester is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | Fmoc-PEG2-C2-NHS ester |
|---|
| Description | Fmoc-PEG2-CH2CH2-NHS ester is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs Alkyl/ether |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Molecular Formula | C26H28N2O8 |
|---|---|
| Molecular Weight | 496.51 |
| InChIKey | MLMVUZTWJNGUEN-UHFFFAOYSA-N |
| SMILES | O=C(CCOCCOCCNC(=O)OCC1c2ccccc2-c2ccccc21)ON1C(=O)CCC1=O |
| Storage condition | 2-8°C |