Bromo-PEG4-CH2CO2tBu
Modify Date: 2025-08-25 11:05:25
Bromo-PEG4-CH2CO2tBu structure
|
Common Name | Bromo-PEG4-CH2CO2tBu | ||
|---|---|---|---|---|
| CAS Number | 1807505-29-8 | Molecular Weight | 371.26 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H27BrO6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Bromo-PEG4-CH2CO2tBuBr-PEG4-CH2-Boc is a PEG- and Alkyl/ether-based PROTAC linker can be used in the synthesis of PROTACs[1]. |
| Name | Br-PEG4-CH2-Boc |
|---|
| Description | Br-PEG4-CH2-Boc is a PEG- and Alkyl/ether-based PROTAC linker can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs Alkyl/ether |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Molecular Formula | C14H27BrO6 |
|---|---|
| Molecular Weight | 371.26 |
| InChIKey | PELYBQFWTCXTNW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)COCCOCCOCCOCCBr |
| Storage condition | -20°C |