CCT 018159 structure
|
Common Name | CCT 018159 | ||
|---|---|---|---|---|
| CAS Number | 171009-07-7 | Molecular Weight | 352.384 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 547.3±50.0 °C at 760 mmHg | |
| Molecular Formula | C20H20N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 284.8±30.1 °C | |
Use of CCT 018159CCT018159, a 3,4-diaryl pyrazoleresorcinol, is a ATP-competitive HSP90 ATPase activity inhibitor with IC50s of 3.2 and 6.6 µM for human Hsp90β and yeast Hsp90, respectively. CCT018159 caused cell cytostasis associated with a G1 arrest and induces apoptosis. CCT018159 inhibits key endothelial and tumor cell functions implicated in invasion and angiogenesis[1]. |
| Name | cct-018159 |
|---|---|
| Synonym | More Synonyms |
| Description | CCT018159, a 3,4-diaryl pyrazoleresorcinol, is a ATP-competitive HSP90 ATPase activity inhibitor with IC50s of 3.2 and 6.6 µM for human Hsp90β and yeast Hsp90, respectively. CCT018159 caused cell cytostasis associated with a G1 arrest and induces apoptosis. CCT018159 inhibits key endothelial and tumor cell functions implicated in invasion and angiogenesis[1]. |
|---|---|
| Related Catalog | |
| Target |
human Hsp90β:3.2 μM (IC50) yeast Hsp90:6.6 μM (IC50) |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 547.3±50.0 °C at 760 mmHg |
| Molecular Formula | C20H20N2O4 |
| Molecular Weight | 352.384 |
| Flash Point | 284.8±30.1 °C |
| Exact Mass | 352.142303 |
| PSA | 87.60000 |
| LogP | 2.79 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
| Index of Refraction | 1.647 |
| InChIKey | OWPMENVYXDJDOW-UHFFFAOYSA-N |
| SMILES | CCc1cc(-c2n[nH]c(C)c2-c2ccc3c(c2)OCCO3)c(O)cc1O |
| 4-[4-(2,3-DIHYDRO-1,4-BENZODIOXIN-6-YL)-3-METHYL-1H-PYRAZOL-5-YL]-6-ETHYLBENZENE-1,3-DIOL |
| 4-[4-(2,3-Dihydro-1,4-benzodioxin-6-yl)-5-methyl-1H-pyrazol-3-yl]-6-ethyl-1,3-benzenediol |
| 4-[4-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-methyl-1H-pyrazol-3-yl]-6-ethylbenzene-1,3-diol |
| CCT-018159 |
| CCT 018159,4-[4-(2,3-Dihydro-1,4-benzodioxin-6-yl)-5-methyl-1H-pyrazol-3-yl]-6-ethyl-1,3-benzenediol |
| 1,3-Benzenediol, 4-[4-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-methyl-1H-pyrazol-3-yl]-6-ethyl- |