PD 145065 structure
|
Common Name | PD 145065 | ||
|---|---|---|---|---|
| CAS Number | 153049-49-1 | Molecular Weight | 950.12900 | |
| Density | 1.24g/cm3 | Boiling Point | 1252.1ºC at 760mmHg | |
| Molecular Formula | C52H67N7O10 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of PD 145065PD 145065 is a highly potent but non-selective endothelin receptor antagonist with an IC50 value of 4 nM for the ETA receptor for rabbit renal artery vascular smooth muscle cells[1]. |
| Name | pd-145065 |
|---|
| Description | PD 145065 is a highly potent but non-selective endothelin receptor antagonist with an IC50 value of 4 nM for the ETA receptor for rabbit renal artery vascular smooth muscle cells[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.24g/cm3 |
|---|---|
| Boiling Point | 1252.1ºC at 760mmHg |
| Molecular Formula | C52H67N7O10 |
| Molecular Weight | 950.12900 |
| Exact Mass | 949.49500 |
| PSA | 264.99000 |
| LogP | 6.61280 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.59 |
| InChIKey | HRAQSWKGRRUBDJ-OMUAVVNCSA-N |
| SMILES | CCC(C)C(NC(=O)C(CC(=O)O)NC(=O)C(CC(C)C)NC(=O)C(NC(C)=O)C1c2ccccc2CCc2ccccc21)C(=O)NC(C(=O)NC(Cc1c[nH]c2ccccc12)C(=O)O)C(C)CC |