UK-1 structure
|
Common Name | UK-1 | ||
|---|---|---|---|---|
| CAS Number | 151271-53-3 | Molecular Weight | 386.35700 | |
| Density | 1.423g/cm3 | Boiling Point | 558.2ºC at 760 mmHg | |
| Molecular Formula | C22H14N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 291.4ºC | |
Use of UK-1UK-1 is a cytotoxic metabolite from Streptomyces sp. 517-02 and exerts a wide spectrum of potent anticancer activities[1]. UK-1 also inhibits HCV replication[2]. |
| Name | methyl 2-[2-(6-oxocyclohexa-2,4-dien-1-ylidene)-3H-1,3-benzoxazol-4-yl]-1,3-benzoxazole-4-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Description | UK-1 is a cytotoxic metabolite from Streptomyces sp. 517-02 and exerts a wide spectrum of potent anticancer activities[1]. UK-1 also inhibits HCV replication[2]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.423g/cm3 |
|---|---|
| Boiling Point | 558.2ºC at 760 mmHg |
| Molecular Formula | C22H14N2O5 |
| Molecular Weight | 386.35700 |
| Flash Point | 291.4ºC |
| Exact Mass | 386.09000 |
| PSA | 98.59000 |
| LogP | 4.79520 |
| Vapour Pressure | 1.71E-12mmHg at 25°C |
| Index of Refraction | 1.687 |
| InChIKey | NGKIDJMAXLRJRL-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cccc2oc(-c3cccc4oc(-c5ccccc5O)nc34)nc12 |
| [2,4'-Bibenzoxazole]-4-carboxylicacid,2'-(2-hydroxyphenyl)-,methyl ester |
| 2'-(2-hydroxyphenyl)-2,4'-bibenzoxazole-4-carboxylic acid methyl ester |
| UK 1(cytotoxin) |
| UK 1 |