Boc-Arg-OH structure
|
Common Name | Boc-Arg-OH | ||
|---|---|---|---|---|
| CAS Number | 13726-76-6 | Molecular Weight | 274.317 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C11H22N4O4 | Melting Point | 117-119 °C | |
| MSDS | Chinese USA | Flash Point | >230 °F | |
Use of Boc-Arg-OH(S)-2-((tert-Butoxycarbonyl)amino)-5-guanidinopentanoic acid is an arginine derivative[1]. |
| Name | (S)-2-((tert-Butoxycarbonyl)amino)-5-guanidinopentanoic acid |
|---|---|
| Synonym | More Synonyms |
| Description | (S)-2-((tert-Butoxycarbonyl)amino)-5-guanidinopentanoic acid is an arginine derivative[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Amino acids and amino acid derivatives have been commercially used as ergogenic supplements. They influence the secretion of anabolic hormones, supply of fuel during exercise, mental performance during stress related tasks and prevent exercise induced muscle damage. They are recognized to be beneficial as ergogenic dietary substances[1]. |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Melting Point | 117-119 °C |
| Molecular Formula | C11H22N4O4 |
| Molecular Weight | 274.317 |
| Flash Point | >230 °F |
| Exact Mass | 274.164093 |
| PSA | 137.53000 |
| LogP | -0.01 |
| Index of Refraction | 1.540 |
| InChIKey | HSQIYOPBCOPMSS-ZETCQYMHSA-N |
| SMILES | CC(C)(C)OC(=O)NC(CCCN=C(N)N)C(=O)O |
| Storage condition | Store at 0°C |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Safety Phrases | S22-S24/25 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2925290090 |
|
~%
Boc-Arg-OH CAS#:13726-76-6 |
| Literature: US4804539 A1, ; |
|
~%
Boc-Arg-OH CAS#:13726-76-6 |
| Literature: Acta Chemica Scandinavica, Series B: Organic Chemistry and Biochemistry, , vol. 40, # 4 p. 235 - 241 |
|
~%
Boc-Arg-OH CAS#:13726-76-6 |
| Literature: Canadian Journal of Chemistry, , vol. 51, # 12 p. 1910 - 1914 |
|
~%
Boc-Arg-OH CAS#:13726-76-6 |
| Literature: Journal of Medicinal Chemistry, , vol. 25, # 10 p. 1209 - 1213 |
|
~%
Boc-Arg-OH CAS#:13726-76-6 |
| Literature: Monatshefte fuer Chemie, , vol. 113, p. 457 - 474 |
|
~%
Boc-Arg-OH CAS#:13726-76-6 |
| Literature: Zeitschrift fuer Chemie (Stuttgart, Germany), , vol. 13, p. 221 - 222 |
| Precursor 8 | |
|---|---|
| DownStream 5 | |
| HS Code | 2925290090 |
|---|---|
| Summary | 2925290090 other imines and their derivatives; salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|
In Vivo Nanodetoxication for Acute Uranium Exposure.
Molecules 20 , 11017-33, (2015) Accidental exposure to uranium is a matter of concern, as U(VI) is nephrotoxic in both human and animal models, and its toxicity is associated to chemical toxicity instead of radioactivity. We synthes... |
| (2S)-5-(diaminomethylideneamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid |
| N(alpha)-Boc-L-arginine |
| L-Arginine, N-[(1,1-dimethylethoxy)carbonyl]- |
| N-(tert-Butoxycarbonyl)-L-arginine |
| (2S)-5-Carbamimidamido-2-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)pentanoic acid |
| Na-(tert-Butoxycarbonyl)-L-arginine |
| EINECS 237-295-2 |
| N-{[(2-Methyl-2-propanyl)oxy]carbonyl}-L-arginine |
| N-(tert-Butoxycarbonyl)-L-arginin |
| MFCD00042632 |
| Boc-Arg-OH |