Boc-Arg(Tos)-OH structure
|
Common Name | Boc-Arg(Tos)-OH | ||
|---|---|---|---|---|
| CAS Number | 13836-37-8 | Molecular Weight | 428.503 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C18H28N4O6S | Melting Point | -90ºC (dec.) | |
| MSDS | Chinese USA | Flash Point | N/A | |
Use of Boc-Arg(Tos)-OH(S)-2-((tert-Butoxycarbonyl)amino)-5-(3-tosylguanidino)pentanoic acid is an arginine derivative[1]. |
| Name | Ornithine, N(2)-carboxy-N(5)-[(p-tolylsulfonyl)amidino]-, N(2)-tert-butyl ester, L |
|---|---|
| Synonym | More Synonyms |
| Description | (S)-2-((tert-Butoxycarbonyl)amino)-5-(3-tosylguanidino)pentanoic acid is an arginine derivative[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Amino acids and amino acid derivatives have been commercially used as ergogenic supplements. They influence the secretion of anabolic hormones, supply of fuel during exercise, mental performance during stress related tasks and prevent exercise induced muscle damage. They are recognized to be beneficial as ergogenic dietary substances[1]. |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Melting Point | -90ºC (dec.) |
| Molecular Formula | C18H28N4O6S |
| Molecular Weight | 428.503 |
| Exact Mass | 428.172943 |
| PSA | 166.06000 |
| LogP | 1.95 |
| Index of Refraction | 1.576 |
| InChIKey | WBIIPXYJAMICNU-AWEZNQCLSA-N |
| SMILES | Cc1ccc(S(=O)(=O)NC(N)=NCCCC(NC(=O)OC(C)(C)C)C(=O)O)cc1 |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Hazard Codes | Xi |
| Safety Phrases | S22-S24/25 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
|
~%
Boc-Arg(Tos)-OH CAS#:13836-37-8 |
| Literature: Tetrahedron Letters, , vol. 40, # 23 p. 4439 - 4442 |
| Precursor 1 | |
|---|---|
| DownStream 9 | |
|
In situ fabrication of cleavable peptide arrays on polydimethylsiloxane and applications for kinase activity assays.
Anal. Chim. Acta 865 , 53-9, (2015) Polydimethylsiloxane (PDMS) is widely used for microfabrication and bioanalysis; however, its surface functionalization is limited due to the lack of active functional groups and incompatibility with ... |
| MFCD04974532 |
| Nα-Boc-Nω-tosyl-L-arginine |
| boc-Ng-tosyl-L-arginine |
| N-(tert-Butoxycarbonyl)-N-{N-[(4-methylphenyl)sulfonyl]carbamimidoyl}-L-ornithine |
| EINECS 237-549-2 |
| nyl]amino]methyl] |
| BOC-L-ARG(TOS) |
| BOC-ARGININE(TOS)-OH |
| N-{N-[(4-Methylphenyl)sulfonyl]carbamimidoyl}-N-{[(2-methyl-2-propanyl)oxy]carbonyl}-L-ornithine |
| Nα-(tert-Butoxycarbonyl)-Nω-(p-toluenesulfonyl)-L-arginine |
| Boc-Arg(Tos)-OH |
| BOC-L ARGININE (TOS) |
| BOC-AMINOACID |
| BOC-ARG(TOS) |
| N-alpha-BOC-N-omega-Tosyl-L-arginine |
| Boc-L-Arg-NTos |
| Boc-tosyl-Arginine |
| Na-Boc-Nw-4-toluenesulfonyl-L-arginine |
| boc-L-Arg(Tos)-OH |
| (2S)-5-{N'-[(4-Methylphenyl)sulfonyl]carbamimidamido}-2-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)pentanoic acid |
| L-Ornithine, N-[(1,1-dimethylethoxy)carbonyl]-N-[imino[[(4-methylphenyl)sulfonyl]amino]methyl]- |
| Boc-Arg(Tosyl)-OH |
| N-Boc-N'-tosyl-L-arginine |