Boc-NH-PEG10-CH2CH2NH2
Modify Date: 2025-08-25 10:01:09
Boc-NH-PEG10-CH2CH2NH2 structure
|
Common Name | Boc-NH-PEG10-CH2CH2NH2 | ||
|---|---|---|---|---|
| CAS Number | 1347704-59-9 | Molecular Weight | 600.74 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C27H56N2O12 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Boc-NH-PEG10-CH2CH2NH2Boc-NH-PEG10-CH2CH2NH2 is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | Boc-NH-PEG10-CH2CH2NH2 |
|---|
| Description | Boc-NH-PEG10-CH2CH2NH2 is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Molecular Formula | C27H56N2O12 |
|---|---|
| Molecular Weight | 600.74 |
| InChIKey | QAZKCSDOOFBCPI-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCN |
| Hazard Codes | Xi |
|---|