H-4-NITRO-D-PHE-OET HCL structure
|
Common Name | H-4-NITRO-D-PHE-OET HCL | ||
|---|---|---|---|---|
| CAS Number | 127641-82-1 | Molecular Weight | 274.70100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H15ClN2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-nitro-D-phenylalanine ethyl ester, hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H15ClN2O4 |
|---|---|
| Molecular Weight | 274.70100 |
| Exact Mass | 274.07200 |
| PSA | 98.14000 |
| LogP | 3.05320 |
| InChIKey | HHZUMTWHYNIFOC-HNCPQSOCSA-N |
| SMILES | CCOC(=O)C(N)Cc1ccc([N+](=O)[O-])cc1.Cl |
| HS Code | 2922499990 |
|---|
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| h-4-nitro-d-phe-oet.hcl |
| h-4-nitro-d-phe-oet hcl |