Biotin-PEG(4)-SS-Alkyne structure
|
Common Name | Biotin-PEG(4)-SS-Alkyne | ||
|---|---|---|---|---|
| CAS Number | 1260247-54-8 | Molecular Weight | 691.92 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C29H49N5O8S3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Biotin-PEG(4)-SS-AlkyneBiotin-PEG(4)-SS-Alkyne is a click chemistry reagent containing an alkyne group. Biotin-PEG(4)-SS-Alkyne can be used for the research of various biochemical[1]. |
| Name | Biotin-PEG(4)-SS-Alkyne |
|---|
| Description | Biotin-PEG(4)-SS-Alkyne is a click chemistry reagent containing an alkyne group. Biotin-PEG(4)-SS-Alkyne can be used for the research of various biochemical[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C29H49N5O8S3 |
|---|---|
| Molecular Weight | 691.92 |
| InChIKey | OBMQVSWBFJZVLH-QONNDPFASA-N |
| SMILES | C#CCCNC(=O)CCSSCCNC(=O)CCOCCOCCOCCOCCNC(=O)CCCC1SCC2NC(=O)NC21 |