Kazinol U
Modify Date: 2025-09-12 19:53:02
Kazinol U structure
|
Common Name | Kazinol U | ||
|---|---|---|---|---|
| CAS Number | 1238116-48-7 | Molecular Weight | 326.39 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 538.8±50.0 °C at 760 mmHg | |
| Molecular Formula | C20H22O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 279.7±30.1 °C | |
Use of Kazinol UKazinol U inhibits melanogenesis through the inhibition of tyrosinase-related proteins via AMPK activation[1]. |
| Name | Kazinol U |
|---|---|
| Synonym | More Synonyms |
| Description | Kazinol U inhibits melanogenesis through the inhibition of tyrosinase-related proteins via AMPK activation[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 538.8±50.0 °C at 760 mmHg |
| Molecular Formula | C20H22O4 |
| Molecular Weight | 326.39 |
| Flash Point | 279.7±30.1 °C |
| Exact Mass | 326.151794 |
| PSA | 69.92000 |
| LogP | 4.57 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
| Index of Refraction | 1.631 |
| InChIKey | MVHAAGZZSATGDD-UHFFFAOYSA-N |
| SMILES | CC(C)=CCc1c(C2CCc3ccc(O)cc3O2)ccc(O)c1O |
| Hazard Codes | Xi |
|---|
| 4-[(2R)-7-Hydroxy-3,4-dihydro-2H-chromen-2-yl]-3-(3-methyl-2-buten-1-yl)-1,2-benzenediol |
| 1,2-Benzenediol, 4-[(2R)-3,4-dihydro-7-hydroxy-2H-1-benzopyran-2-yl]-3-(3-methyl-2-buten-1-yl)- |