TSHR antagonist S37 structure
|
Common Name | TSHR antagonist S37 | ||
|---|---|---|---|---|
| CAS Number | 1217616-61-9 | Molecular Weight | 460.57 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C25H20N2O3S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of TSHR antagonist S37TSHR antagonist S37 is a selective and competitive thyrotropin receptor (TSHR) antagonist. TSHR antagonist S37 is the racemate of TSHR antagonist S37a[1]. |
| Name | TSHR antagonist S37 |
|---|
| Description | TSHR antagonist S37 is a selective and competitive thyrotropin receptor (TSHR) antagonist. TSHR antagonist S37 is the racemate of TSHR antagonist S37a[1]. |
|---|---|
| Related Catalog | |
| Target |
TSHR[1] |
| In Vitro | TSHR antagonist S37 reduces also cAMP activation induced by the small molecule agonist C2[1]. TSHR antagonist S37 (10-100 µM) does not affect cell viability in the concentration range for the Hek293T-TSHR cell line[1]. |
| References |
| Molecular Formula | C25H20N2O3S2 |
|---|---|
| Molecular Weight | 460.57 |
| InChIKey | YGFJFPYQZCZNIH-UHFFFAOYSA-N |
| SMILES | O=C1C2C3CC(C2C(=O)N1c1ccccc1)C1C(c2ccccc2)c2sc(=O)[nH]c2SC31 |