m-PEG8-CH2COOH
Modify Date: 2025-09-11 19:06:25
m-PEG8-CH2COOH structure
|
Common Name | m-PEG8-CH2COOH | ||
|---|---|---|---|---|
| CAS Number | 102013-72-9 | Molecular Weight | 442.49800 | |
| Density | 1.122 | Boiling Point | N/A | |
| Molecular Formula | C19H38O11 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of m-PEG8-CH2COOHm-PEG8-CH2COOH is a PEG--based PROTAC linker can be used in the synthesis of PROTACs. |
| Name | 2-[2-[2-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]acetic acid |
|---|---|
| Synonym | More Synonyms |
| Description | m-PEG8-CH2COOH is a PEG--based PROTAC linker can be used in the synthesis of PROTACs. |
|---|---|
| Related Catalog | |
| Target |
PEGs |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins. |
| References |
[1]. Alexander Chucholowski, et al. Cyclodextrin conjugates. WO2010017328A2. |
| Density | 1.122 |
|---|---|
| Molecular Formula | C19H38O11 |
| Molecular Weight | 442.49800 |
| Exact Mass | 442.24100 |
| PSA | 120.37000 |
| InChIKey | AOKQPSPNBHUGLR-UHFFFAOYSA-N |
| SMILES | COCCOCCOCCOCCOCCOCCOCCOCCOCC(=O)O |
| Hazard Codes | Xi |
|---|
|
~%
m-PEG8-CH2COOH CAS#:102013-72-9 |
| Literature: CIBA Patent: US2769838 , 1954 ; |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 3,6,9,12,15,18,21,24,27-nonaoxa-octacosanoic acid |
| 3,6,9,12,15,18,21,24,27-Nonaoxa-octacosansaeure |