A01
Modify Date: 2025-08-25 22:50:39
A01 structure
|
Common Name | A01 | ||
|---|---|---|---|---|
| CAS Number | 1007647-73-5 | Molecular Weight | 512.93 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 642.3±65.0 °C at 760 mmHg | |
| Molecular Formula | C22H20ClF3N4O3S | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 342.2±34.3 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
Use of A01Smurf1-IN-A01 (A01) is an ubiquitin ligase Smad ubiquitination regulatory factor-1 (Smurf1) inhibitor with a kd of 3.664 nM, which increases BMP-2 responsiveness by inhibiting Smurf1-mediated Smad1/5 degradation[1]. |
| Name | (4-{[4-Chloro-3-(trifluoromethyl)phenyl]sulfonyl}-1-piperazinyl)[4-(5-methyl-1H-pyrazol-1-yl)phenyl]methanone |
|---|---|
| Synonym | More Synonyms |
| Description | Smurf1-IN-A01 (A01) is an ubiquitin ligase Smad ubiquitination regulatory factor-1 (Smurf1) inhibitor with a kd of 3.664 nM, which increases BMP-2 responsiveness by inhibiting Smurf1-mediated Smad1/5 degradation[1]. |
|---|---|
| Related Catalog | |
| Target |
Kd: 3.664 nM (Smurf1)[1] |
| References |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 642.3±65.0 °C at 760 mmHg |
| Molecular Formula | C22H20ClF3N4O3S |
| Molecular Weight | 512.93 |
| Flash Point | 342.2±34.3 °C |
| Exact Mass | 512.089661 |
| LogP | 3.87 |
| Vapour Pressure | 0.0±1.9 mmHg at 25°C |
| Index of Refraction | 1.627 |
| InChIKey | QFYLTUDRXBNZFQ-UHFFFAOYSA-N |
| SMILES | Cc1ccnn1-c1ccc(C(=O)N2CCN(S(=O)(=O)c3ccc(Cl)c(C(F)(F)F)c3)CC2)cc1 |
| Storage condition | 2-8℃ |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P280-P304 + P340 + P312-P305 + P351 + P338-P337 + P313 |
| RIDADR | NONH for all modes of transport |
| (4-{[4-Chloro-3-(trifluoromethyl)phenyl]sulfonyl}-1-piperazinyl)[4-(5-methyl-1H-pyrazol-1-yl)phenyl]methanone |
| Methanone, [4-[[4-chloro-3-(trifluoromethyl)phenyl]sulfonyl]-1-piperazinyl][4-(5-methyl-1H-pyrazol-1-yl)phenyl]- |
| MFCD09320899 |