MIF-IN-3
Modify Date: 2025-08-26 22:00:21
MIF-IN-3 structure
|
Common Name | MIF-IN-3 | ||
|---|---|---|---|---|
| CAS Number | 2756410-83-8 | Molecular Weight | 428.46 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H20N4O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of MIF-IN-3MIF-IN-3 is a migration inhibitory factor (MIF) inhibitor extracted from patent WO2021258272A1 compound 31. MIF-IN-3 can be used for the research of immune inflammation-related diseases[1]. |
| Name | MIF-IN-3 |
|---|
| Description | MIF-IN-3 is a migration inhibitory factor (MIF) inhibitor extracted from patent WO2021258272A1 compound 31. MIF-IN-3 can be used for the research of immune inflammation-related diseases[1]. |
|---|---|
| Related Catalog | |
| References |
[1]. FAN G, et, al. Compounds and their uses as mif inhibitors. WO2021258272A1. |
| Molecular Formula | C20H20N4O5S |
|---|---|
| Molecular Weight | 428.46 |
| InChIKey | DDYQIVGQBXREES-UHFFFAOYSA-N |
| SMILES | COc1cc(N2CCCC(C(=O)O)C2)ccc1C(=O)Nc1nnc(-c2cccs2)o1 |