Angiotensin II structure
|
Common Name | Angiotensin II | ||
|---|---|---|---|---|
| CAS Number | 11128-99-7 | Molecular Weight | 1046.18000 | |
| Density | 1.43g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C50H71N13O12 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Angiotensin IIAngiotensin II is a Vasoconstrictor that plays an endocrine role in the regulation of blood pressure, fluid and electrolyte homeostasis. |
| Name | Ile5-angiotensin II |
|---|---|
| Synonym | More Synonyms |
| Description | Angiotensin II is a Vasoconstrictor that plays an endocrine role in the regulation of blood pressure, fluid and electrolyte homeostasis. |
|---|---|
| Related Catalog | |
| Target |
Human Endogenous Metabolite |
| References |
| Density | 1.43g/cm3 |
|---|---|
| Molecular Formula | C50H71N13O12 |
| Molecular Weight | 1046.18000 |
| Exact Mass | 1045.53000 |
| PSA | 427.28000 |
| LogP | 5.76590 |
| Index of Refraction | 1.671 |
| InChIKey | CZGUSIXMZVURDU-UHFFFAOYSA-N |
| SMILES | CCC(C)C(NC(=O)C(Cc1ccc(O)cc1)NC(=O)C(NC(=O)C(CCCN=C(N)N)NC(=O)C(N)CC(=O)O)C(C)C)C(=O)NC(Cc1cnc[nH]1)C(=O)N1CCCC1C(=O)NC(Cc1ccccc1)C(=O)O |
| Valyl(5)-Angiotensin II |
| Ile(5)-angiotensin II |
| 1-L-Aspasaginyl-5-L-valyl angiotensin octapeptide |
| 3-amino-4-[[1-[[1-[[1-[[1-[[1-[2-[(1-carboxy-2-phenylethyl)carbamoyl]pyrrolidin-1-yl]-3-(1H-imidazol-5-yl)-1-oxopropan-2-yl]amino]-3-methyl-1-oxopentan-2-yl]amino]-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]amino]-5-(diaminomethy |
| Angiotensin II,Val(5) |
| ANG-(1-8)Octapeptide |
| Angiotensinum II [INN-Latin] |
| Angiotensina II [INN-Spanish] |
| 1-8-Angiotensin I |
| Isoleucine(5)-Angiotensin |