Epimedin B structure
|
Common Name | Epimedin B | ||
|---|---|---|---|---|
| CAS Number | 110623-73-9 | Molecular Weight | 808.776 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 1066.1±65.0 °C at 760 mmHg | |
| Molecular Formula | C38H48O19 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 325.6±27.8 °C | |
Use of Epimedin BEpimedin B, a component extracted from Epimedii Folium, is reported to have antiosteoporotic activity.IC50 value:Target:In vitro:In vivo: Prednisolone-induced osteoporosis model using zebrafish was used to evaluate the antiosteoporotic activity of micro amount epimedin B. The result showed that 1 μmol·L- 1epimedin B groups were significantly increased when compared with model group; Epimedin B can prevent zebrafish osteoporosis induced by prednisolone [1]. |
| Name | 3-[(2S,3R,4R,5R,6S)-4,5-dihydroxy-6-methyl-3-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxyoxan-2-yl]oxy-5-hydroxy-2-(4-methoxyphenyl)-8-(3-methylbut-2-enyl)-7-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-4-one |
|---|---|
| Synonym | More Synonyms |
| Description | Epimedin B, a component extracted from Epimedii Folium, is reported to have antiosteoporotic activity.IC50 value:Target:In vitro:In vivo: Prednisolone-induced osteoporosis model using zebrafish was used to evaluate the antiosteoporotic activity of micro amount epimedin B. The result showed that 1 μmol·L- 1epimedin B groups were significantly increased when compared with model group; Epimedin B can prevent zebrafish osteoporosis induced by prednisolone [1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 1066.1±65.0 °C at 760 mmHg |
| Molecular Formula | C38H48O19 |
| Molecular Weight | 808.776 |
| Flash Point | 325.6±27.8 °C |
| Exact Mass | 808.278992 |
| PSA | 297.12000 |
| LogP | 2.87 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |
| Index of Refraction | 1.685 |
| InChIKey | OCZZCFAOOWZSRX-LRHLXKJSSA-N |
| SMILES | COc1ccc(-c2oc3c(CC=C(C)C)c(OC4OC(CO)C(O)C(O)C4O)cc(O)c3c(=O)c2OC2OC(C)C(O)C(O)C2OC2OCC(O)C(O)C2O)cc1 |
| Hazard Codes | Xi |
|---|
| Epmedin B |
| 3-{[6-Deoxy-2-O-(β-D-xylopyranosyl)-α-L-mannopyranosyl]oxy}-5-hydroxy-2-(4-methoxyphenyl)-8-(3-methyl-2-buten-1-yl)-4-oxo-4H-chromen-7-yl β-D-glucopyranoside |
| 3-{[6-Deoxy-2-O-(β-D-xylopyranosyl)-α-L-mannopyranosyl]oxy}-5-hydroxy-2-(4-methoxyphenyl)-8-(3-methylbut-2-en-1-yl)-4-oxo-4H-chromen-7-yl β-D-glucopyranoside |
| EpimedinB |
| Epimedin B |