dimethyl 2,2-bis(prop-2-enyl)propanedioate structure
|
Common Name | dimethyl 2,2-bis(prop-2-enyl)propanedioate | ||
|---|---|---|---|---|
| CAS Number | 35357-77-8 | Molecular Weight | 212.24200 | |
| Density | 1.023g/cm3 | Boiling Point | 209.7ºC at 760mmHg | |
| Molecular Formula | C11H16O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 87.2ºC | |
| Name | dimethyl 2,2-bis(prop-2-enyl)propanedioate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.023g/cm3 |
|---|---|
| Boiling Point | 209.7ºC at 760mmHg |
| Molecular Formula | C11H16O4 |
| Molecular Weight | 212.24200 |
| Flash Point | 87.2ºC |
| Exact Mass | 212.10500 |
| PSA | 52.60000 |
| LogP | 1.47100 |
| Index of Refraction | 1.452 |
| InChIKey | SZIREXDQZMDDJM-UHFFFAOYSA-N |
| SMILES | C=CCC(CC=C)(C(=O)OC)C(=O)OC |
| Safety Phrases | S24/25 |
|---|---|
| HS Code | 2917190090 |
| Precursor 10 | |
|---|---|
| DownStream 5 | |
| HS Code | 2917190090 |
|---|---|
| Summary | 2917190090 acyclic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| dimethyl bis-allyl malonate |
| Dimethyl diallylmalonate |
| dimethyl 2,2-di(2-propenyl)malonate |
| dimethyl hept-1,6-dienyl-4,4-dicarboxylate |
| methyl 2-methoxycarbonyl-2-allyl-4-pentenoate |
| 2,2-diallylmalonic acid dimethyl ester |
| EINECS 252-526-7 |
| (MeO2C)2C(CH2CH=CH2)2 |
| dimethyl 2,2-diallylmalonate |