Diethyl diallylmalonate
Modify Date: 2025-08-25 21:10:17
Diethyl diallylmalonate structure
|
Common Name | Diethyl diallylmalonate | ||
|---|---|---|---|---|
| CAS Number | 3195-24-2 | Molecular Weight | 240.296 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 243.5±0.0 °C at 760 mmHg | |
| Molecular Formula | C13H20O4 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 106.7±24.4 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | diethyl 2,2-bis(prop-2-enyl)propanedioate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 243.5±0.0 °C at 760 mmHg |
| Molecular Formula | C13H20O4 |
| Molecular Weight | 240.296 |
| Flash Point | 106.7±24.4 °C |
| Exact Mass | 240.136154 |
| PSA | 52.60000 |
| LogP | 3.41 |
| Vapour Pressure | 0.0±0.4 mmHg at 25°C |
| Index of Refraction | 1.455 |
| InChIKey | LYUUVYQGUMRKOV-UHFFFAOYSA-N |
| SMILES | C=CCC(CC=C)(C(=O)OCC)C(=O)OCC |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | 36/37/38 |
| Safety Phrases | S26-S37/39 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2917190090 |
| HS Code | 2917190090 |
|---|---|
| Summary | 2917190090 acyclic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|
Low catalyst loading in ring-closing metathesis reactions.
Chemistry 19(3) , 1002-12, (2013) An efficient procedure is described for ring-closing metathesis reactions. A conversion of 95% for diethyl diallylmalonate in dilute solution could be achieved within a few minutes, reaching TOF = 417... |
|
|
Nickel catalysed asymmetric cycloisomerisation of diethyl diallylmalonate.
Chem. Commun. (Camb.) (11) , 1456-8, (2005) Cationic nickel catalysts with monodentate phosphoramidites and Wilke's azaphospholene as ligands are highly regio- and enantioselective catalysts for the cycloisomerisation of diethyl diallylmalonate... |
| Diethyl diallylmalonate |
| diethyl 2,2-diprop-2-enylpropane-1,3-dioate |
| Malonic acid, diallyl-, diethyl ester |
| Diallylmalonic Acid Diethyl Ester |
| EINECS 221-696-4 |
| diethyl 2,2-diallylmalonate |
| Propanedioic acid, 2,2-di-2-propen-1-yl-, diethyl ester |
| Propanedioic acid, di-2-propenyl-, diethyl ester |
| MFCD00009126 |