MK-0952 structure
|
Common Name | MK-0952 | ||
|---|---|---|---|---|
| CAS Number | 934995-87-6 | Molecular Weight | 483.49000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C28H22FN3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of MK-0952MK-0952 is a selective and orally active PDE4 inhibitor, with an IC50 of 0.53 nM. MK-0952 has the potential for Alzheimer’s disease study[1][2]. |
| Name | (1R,2R)-2-{3'-[3-(Cyclopropylcarbamoyl)-4-oxo-1,8-naphthyridin-1( 4H)-yl]-3-fluoro-4-biphenylyl}cyclopropanecarboxylic acid |
|---|
| Description | MK-0952 is a selective and orally active PDE4 inhibitor, with an IC50 of 0.53 nM. MK-0952 has the potential for Alzheimer’s disease study[1][2]. |
|---|---|
| Related Catalog | |
| Target |
PDE4:0.53 nM (IC50) |
| In Vivo | MK-0952 (10 mg/kg) induces malaise in the rat[1]. |
| References |
| Molecular Formula | C28H22FN3O4 |
|---|---|
| Molecular Weight | 483.49000 |
| Exact Mass | 483.15900 |
| PSA | 104.78000 |
| LogP | 4.84690 |
| InChIKey | PSYPBAHXIIVDCJ-FCHUYYIVSA-N |
| SMILES | O=C(NC1CC1)c1cn(-c2cccc(-c3ccc(C4CC4C(=O)O)c(F)c3)c2)c2ncccc2c1=O |