GSK-1 structure
|
Common Name | GSK-1 | ||
|---|---|---|---|---|
| CAS Number | 912953-25-4 | Molecular Weight | 291.268 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 429.5±45.0 °C at 760 mmHg | |
| Molecular Formula | C16H12F3NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 213.5±28.7 °C | |
| Name | Eg5 Inhibitor VII |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 429.5±45.0 °C at 760 mmHg |
| Molecular Formula | C16H12F3NO |
| Molecular Weight | 291.268 |
| Flash Point | 213.5±28.7 °C |
| Exact Mass | 291.087097 |
| LogP | 4.37 |
| Appearance of Characters | off-white powder |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.541 |
| InChIKey | WNVWLPPJRMIRBG-UHFFFAOYSA-N |
| SMILES | O=C1CCc2cc(-c3ccc(C(F)(F)F)cc3)ccc2N1 |
| Storage condition | Store at 4° C |
| Water Solubility | Soluble in DMSO (10 mg/ml). |
| 2(1H)-Quinolinone, 3,4-dihydro-6-[4-(trifluoromethyl)phenyl]- |
| 6-[4-(Trifluoromethyl)phenyl]-3,4-dihydro-2(1H)-quinolinone |
| GSK-1 |