GSK-1482160 structure
|
Common Name | GSK-1482160 | ||
|---|---|---|---|---|
| CAS Number | 1001389-72-5 | Molecular Weight | 334.72100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H14ClF3N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of GSK-1482160GSK-1482160 is an orally available negative allosteric modulator of the P2X7 receptor. P2X7 receptors are involved in the production of pro-inflammatory cytokines, such as Il-1β, by central and peripheral immune cells. GSK-1482160 has the potential for the research of inflammation diseases[1]. |
| Name | N-{[2-chloro-3-(trifluoromethyl)phenyl]methyl}-1-methyl-5-oxo-L-prolinamide |
|---|
| Description | GSK-1482160 is an orally available negative allosteric modulator of the P2X7 receptor. P2X7 receptors are involved in the production of pro-inflammatory cytokines, such as Il-1β, by central and peripheral immune cells. GSK-1482160 has the potential for the research of inflammation diseases[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C14H14ClF3N2O2 |
|---|---|
| Molecular Weight | 334.72100 |
| Exact Mass | 334.07000 |
| PSA | 49.41000 |
| LogP | 2.92460 |
| InChIKey | BJEMSIVBBUBXMZ-UHFFFAOYSA-N |
| SMILES | CN1C(=O)CCC1C(=O)NCc1cccc(C(F)(F)F)c1Cl |