7-Keto-3α,12-α-dihydroxycholanic Acid
Modify Date: 2025-09-18 22:24:23
7-Keto-3α,12-α-dihydroxycholanic Acid structure
|
Common Name | 7-Keto-3α,12-α-dihydroxycholanic Acid | ||
|---|---|---|---|---|
| CAS Number | 911-40-0 | Molecular Weight | 406.55600 | |
| Density | 1.18g/cm3 | Boiling Point | 583ºC at 760mmHg | |
| Molecular Formula | C24H38O5 | Melting Point | 54-60ºC | |
| MSDS | N/A | Flash Point | 320.4ºC | |
Use of 7-Keto-3α,12-α-dihydroxycholanic Acid7-keto-lithocholic acid is a metabolite of bile acids in Clostridium absonum. 7-keto-lithocholic acid is also converted from Lactobacillus and Bifidobacterium with specific condition[1][2]. |
| Name | 3α,12α-dihydroxy-7-oxo-5β-cholanic acid |
|---|---|
| Synonym | More Synonyms |
| Description | 7-keto-lithocholic acid is a metabolite of bile acids in Clostridium absonum. 7-keto-lithocholic acid is also converted from Lactobacillus and Bifidobacterium with specific condition[1][2]. |
|---|---|
| Related Catalog | |
| In Vitro | 7-keto-lithocholic acid shows an increasing bioconversion rate with addition of an equimolar concentration of deoxycholic acid (which itself is not metabolized)[1]. 7-keto-lithocholic acid is induced by deoxycholic acid and then it's metabolized[1]. E. lentum-like c-25 converts 81.7% of 2 mM cholic acid to deoxycholic acid and 3.7% to 7-keto-deoxycholic acid under anaerobic incubation[2]. E. lentum-like c-25 converts 91.5% of 150 mg/mL cholic acid to deoxycholic acid and 1.1% to 7-keto-deoxycholic acid under anaerobic incubation[2]. |
| References |
| Density | 1.18g/cm3 |
|---|---|
| Boiling Point | 583ºC at 760mmHg |
| Melting Point | 54-60ºC |
| Molecular Formula | C24H38O5 |
| Molecular Weight | 406.55600 |
| Flash Point | 320.4ºC |
| Exact Mass | 406.27200 |
| PSA | 94.83000 |
| LogP | 3.65690 |
| Index of Refraction | 1.55 |
| InChIKey | RHCPKKNRWFXMAT-RRWYKFPJSA-N |
| SMILES | CC(CCC(=O)O)C1CCC2C3C(=O)CC4CC(O)CCC4(C)C3CC(O)C12C |
| Hazard Codes | T |
|---|
| Precursor 0 | |
|---|---|
| DownStream 3 | |
CAS#:81-25-4
CAS#:2955-27-3
CAS#:133181-57-4| (3alpha,5beta,12alpha)-3,12-Dihydroxy-7-oxocholan-24-oic acid |
| 7-Ketodeoxycholic acid |
| 7-ketodeoxycholate |
| (4R)-4-[(3R,5S,8R,9S,10S,12S,13R,14S,17R)-3,12-dihydroxy-10,13-dimethyl-7-oxo-1,2,3,4,5,6,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]pentanoic acid |
| 7-oxodeoxycholate |
| 3alpha,12alpha-Diol-7-one-5beta-cholanoic acid |
| 3alpha,12alpha-Dihydroxy-7-oxo-5beta-cholan-24-oic Acid |
| 7-Oxodeoxycholic acid |
| 3alpha,12alpha-dihydroxy-7-oxo-5beta-cholanic acid |
| 3a,12a-dihydroxy-7-oxo-5b-cholan-24-oic acid |
| 7-Keto-3α,12-α-dihydroxycholanic Acid |