ERAP1-IN-1
Modify Date: 2025-08-25 08:56:27
ERAP1-IN-1 structure
|
Common Name | ERAP1-IN-1 | ||
|---|---|---|---|---|
| CAS Number | 865273-97-8 | Molecular Weight | 458.45 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H21F3N2O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of ERAP1-IN-1ERAP1-IN-1 is an endoplasmic reticulum aminopeptidase 1 (ERAP1) inhibitor. ERAP1-IN-1 competitively inhibits ERAP1 activity towards a nonamer peptide representative of physiological substrates[1]. |
| Name | ERAP1-IN-1 |
|---|
| Description | ERAP1-IN-1 is an endoplasmic reticulum aminopeptidase 1 (ERAP1) inhibitor. ERAP1-IN-1 competitively inhibits ERAP1 activity towards a nonamer peptide representative of physiological substrates[1]. |
|---|---|
| Related Catalog | |
| Target |
ERAP1[1] |
| In Vitro | ERAP1-IN-1 allosterically activates ERAP1’s hydrolysis of fluorogenic and chromogenic amino acid substratesv[1]. ERAP1-IN-1 (50 µM) exhibits specific inhibition of ERAP1 in the cellular context[1]. |
| References |
| Molecular Formula | C20H21F3N2O5S |
|---|---|
| Molecular Weight | 458.45 |
| InChIKey | NDYXAJZYGMHQDN-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(=O)O)cc1S(=O)(=O)Nc1cc(C(F)(F)F)ccc1N1CCCCC1 |
| Hazard Codes | Xi |
|---|