Cefteram pivoxil
Modify Date: 2025-08-22 19:27:14
Cefteram pivoxil structure
|
Common Name | Cefteram pivoxil | ||
|---|---|---|---|---|
| CAS Number | 82547-58-8 | Molecular Weight | 479.49 | |
| Density | 1.95 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C16H17N9O5S2 | Melting Point | >175ºC (dec.) | |
| MSDS | N/A | Flash Point | N/A | |
Use of Cefteram pivoxilCefteram (T-2525) is the free acid of Cefteram pivoxil (HY-106571), which is an orally active cephalosporin ester. Cefteram potently targets to the enteropathogenic Enterobacteriaceae and Vibrionaceae[1]. |
| Name | (6R,7R)-7-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-3-[(5-methyltetrazol-2-yl)methyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Cefteram (T-2525) is the free acid of Cefteram pivoxil (HY-106571), which is an orally active cephalosporin ester. Cefteram potently targets to the enteropathogenic Enterobacteriaceae and Vibrionaceae[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.95 g/cm3 |
|---|---|
| Melting Point | >175ºC (dec.) |
| Molecular Formula | C16H17N9O5S2 |
| Molecular Weight | 479.49 |
| Exact Mass | 479.07900 |
| PSA | 244.35000 |
| Index of Refraction | 1.901 |
| InChIKey | XSPUSVIQHBDITA-RKYNPMAHSA-N |
| SMILES | CON=C(C(=O)NC1C(=O)N2C(C(=O)O)=C(Cn3nnc(C)n3)CSC12)c1csc(N)n1 |
| Storage condition | -20?C Freezer |
| Hazard Codes | Xn |
|---|---|
| Risk Phrases | R22:Harmful if swallowed. R37/38:Irritating to respiratory system and skin . R41:Risk of serious damage to eyes. |
| Safety Phrases | S26-S39 |
| RIDADR | UN 1993 3/PG 3 |
| WGK Germany | 3 |
|
~%
Cefteram pivoxil CAS#:82547-58-8 |
| Literature: Chemical and Pharmaceutical Bulletin, , vol. 37, # 9 p. 2369 - 2374 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| Cefteramum [Latin] |
| Cefteramum |
| Cefteram (INN) |
| Ro 19-5247 |
| Ceftetrame |
| CFTM |
| 7-[(Z)-2-(2-aminothiazol-4-yl)-2-methoxyiminoacetamido]-3-[2-(5-methyl-1,2,3,4-tetrazoyl)-methyl]-3-cephem-4-carboxylic acid |
| Cefteram |
| MFCD00864913 |
| Cefterame |