2-Cefteram Pivoxil, 1:1 mixture with Cefteram Pivoxil (C244300) structure
|
Common Name | 2-Cefteram Pivoxil, 1:1 mixture with Cefteram Pivoxil (C244300) | ||
|---|---|---|---|---|
| CAS Number | 104712-44-9 | Molecular Weight | 593.63600 | |
| Density | 1.662g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C22H27N9O7S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-Cefteram Pivoxil, 1:1 mixture with Cefteram Pivoxil (C244300) |
|---|---|
| Synonym | More Synonyms |
| Density | 1.662g/cm3 |
|---|---|
| Molecular Formula | C22H27N9O7S2 |
| Molecular Weight | 593.63600 |
| Exact Mass | 593.14700 |
| PSA | 259.65000 |
| LogP | 0.72330 |
| Index of Refraction | 1.744 |
| InChIKey | OXSIJKGBMZQPQF-QWIQBTIHSA-N |
| SMILES | CON=C(C(=O)NC1C(=O)N2C(C(=O)OCOC(=O)C(C)(C)C)C(Cn3nnc(C)n3)=CSC12)c1csc(N)n1 |
| T 2588A |
| (6R,7R)-7-[(Z)-2-(2-Aminothiazol-4-yl)-2-methoxyiminoacetylamino]-3-[(5-methyl-2H-tetrazol-2-yl)methyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-3-ene-2-carboxylic acid pivaloyloxymethyl ester |
| (6R,7R)-7-[[(2Z)-(2-AMino-4-thiazolyl)(MethoxyiMino)acetyl]aMino]-3-[(5-Methyl-2H-tetrazol-2-yl)Methyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-3-ene-2-carboxylic Acid (2,2-DiMethyl-1-oxopropoxy)Methyl Ester |
| ∆2-Cefteram Pivoxil |