Brevetoxin2(PbTx-2) structure
|
Common Name | Brevetoxin2(PbTx-2) | ||
|---|---|---|---|---|
| CAS Number | 79580-28-2 | Molecular Weight | 895.08200 | |
| Density | 1.188g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C50H70O14 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Brevetoxin2(PbTx-2)Brevetoxin B (Brevetoxin-2; PbTx-2) is a polyketide neurotoxin produced by Karenia species and other dinoflagellates. Brevetoxin B binds to site 5 on the alpha subunit of voltage-gated sodium channels (IC50=15 nM) on neurons at the neuromuscular junction, causing the channel to open irreversibly at potentials more negative than normal, discharging action potentials repetitively. Brevetoxin B is ichthyotoxic at nanomolar concentrations and is responsible for an illness described as neurotoxic shellfish poisoning. |
| Name | brevetoxin b |
|---|---|
| Synonym | More Synonyms |
| Description | Brevetoxin B (Brevetoxin-2; PbTx-2) is a polyketide neurotoxin produced by Karenia species and other dinoflagellates. Brevetoxin B binds to site 5 on the alpha subunit of voltage-gated sodium channels (IC50=15 nM) on neurons at the neuromuscular junction, causing the channel to open irreversibly at potentials more negative than normal, discharging action potentials repetitively. Brevetoxin B is ichthyotoxic at nanomolar concentrations and is responsible for an illness described as neurotoxic shellfish poisoning. |
|---|---|
| Related Catalog |
| Density | 1.188g/cm3 |
|---|---|
| Molecular Formula | C50H70O14 |
| Molecular Weight | 895.08200 |
| Exact Mass | 894.47700 |
| PSA | 155.90000 |
| LogP | 5.47210 |
| Index of Refraction | 1.522 |
| InChIKey | LYTCVQQGCSNFJU-FGRVLNGBSA-N |
| SMILES | C=C(C=O)CC1CC(O)C2(C)OC3CC4OC5CC6(C)OC7(C)CCC8OC9CC%10(C)OC%11C(C)=CC(=O)OC%11CC%10OC9CC(C)C8OC7CC6OC5(C)CC=CC4OC3CC2O1 |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Hazard Codes | T+: Very toxic; |
|---|---|
| Risk Phrases | 26/27/28 |
| Safety Phrases | 22-36/37/39-45 |
| RIDADR | UN 2811 6.1/PG 2 |
| Hazard Class | 6.1(a) |
|
~%
Brevetoxin2(PbTx-2) CAS#:79580-28-2 |
| Literature: Kadota, Isao; Takamura, Hiroyoshi; Nishii, Hiroki; Yamamoto, Yoshinori Journal of the American Chemical Society, 2005 , vol. 127, # 25 p. 9246 - 9250 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| brevetoxin-B |
| gb2 |
| btx-b |
| PBTX-2 |
| toxint-34 |
| t4-7 |
| GBTX-2 |
| t4-7toxin |
| gb2toxin |
| BREVETOXIN 2 |