Sarmazenil
Modify Date: 2025-08-22 11:16:38
Sarmazenil structure
|
Common Name | Sarmazenil | ||
|---|---|---|---|---|
| CAS Number | 78771-13-8 | Molecular Weight | 319.74300 | |
| Density | 1.43g/cm3 | Boiling Point | 554ºC at 760 mmHg | |
| Molecular Formula | C15H14ClN3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 288.9ºC | |
Use of SarmazenilSarmazenil is a benzodiazepine receptor antagonist. |
| Name | ethyl 7-chloro-5-methyl-6-oxo-4H-imidazo[1,5-a][1,4]benzodiazepine-3-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Description | Sarmazenil is a benzodiazepine receptor antagonist. |
|---|---|
| Related Catalog | |
| Target |
Benzodiazepine receptor[1] |
| References |
| Density | 1.43g/cm3 |
|---|---|
| Boiling Point | 554ºC at 760 mmHg |
| Molecular Formula | C15H14ClN3O3 |
| Molecular Weight | 319.74300 |
| Flash Point | 288.9ºC |
| Exact Mass | 319.07200 |
| PSA | 64.43000 |
| LogP | 2.22590 |
| Index of Refraction | 1.658 |
| InChIKey | WSDBAFQWNWJTNG-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1ncn2c1CN(C)C(=O)c1c(Cl)cccc1-2 |
| Storage condition | 2-8℃ |
|
~%
Sarmazenil CAS#:78771-13-8 |
| Literature: Hoffman-La Roche Inc. Patent: US4316839 A1, 1982 ; |
|
~%
Sarmazenil CAS#:78771-13-8 |
| Literature: Watjen, Frank; Baker, Raymond; Engelstoff, Mogens; Herbert, Richard; MacLeod, Angus; et al. Journal of Medicinal Chemistry, 1989 , vol. 32, # 10 p. 2282 - 2291 |
CAS#:122384-14-9| Sarmazenilum |
| Sarmazenil |
| sarmazenil[inn] |
| ethyl 7-chloro-5-methyl-6-oxo-5,6-dihydro-4H-imidazo[1,5-a][1,4]benzodiazepine-3-carboxylate |
| Sarmazenilum [INN-Latin] |
| ethyl 7-chloro-5,6-dihydro-5-methyl-6-oxo-4H-imidazo[1,5-a][1,4]benzodiazepine-3-carboxylate |