FMRF
Modify Date: 2025-08-25 08:55:27
FMRF structure
|
Common Name | FMRF | ||
|---|---|---|---|---|
| CAS Number | 74012-06-9 | Molecular Weight | 599.74500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C29H41N7O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of FMRFFMRF is a peptide consisting of 4 amino acid residues. |
| Name | (2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-amino-3-phenylpropanoyl]amino]-4-methylsulfanylbutanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-phenylpropanoic acid |
|---|---|
| Synonym | More Synonyms |
| Description | FMRF is a peptide consisting of 4 amino acid residues. |
|---|---|
| Related Catalog |
| Molecular Formula | C29H41N7O5S |
|---|---|
| Molecular Weight | 599.74500 |
| Exact Mass | 599.28900 |
| PSA | 248.29000 |
| LogP | 4.76660 |
| InChIKey | QXYYONMTJKILDK-ZJZGAYNASA-N |
| SMILES | CSCCC(NC(=O)C(N)Cc1ccccc1)C(=O)NC(CCCN=C(N)N)C(=O)NC(Cc1ccccc1)C(=O)O |
| Storage condition | 2-8℃ |
| L-Phenylalanine,L-phenylalanyl-L-methionyl-L-arginyl |