2-(methylphenylamino)-2-oxoethyl acetate structure
|
Common Name | 2-(methylphenylamino)-2-oxoethyl acetate | ||
|---|---|---|---|---|
| CAS Number | 73251-32-8 | Molecular Weight | 207.22600 | |
| Density | 1.18g/cm3 | Boiling Point | 342ºC at 760 mmHg | |
| Molecular Formula | C11H13NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 160.7ºC | |
| Name | [2-(N-methylanilino)-2-oxoethyl] acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.18g/cm3 |
|---|---|
| Boiling Point | 342ºC at 760 mmHg |
| Molecular Formula | C11H13NO3 |
| Molecular Weight | 207.22600 |
| Flash Point | 160.7ºC |
| Exact Mass | 207.09000 |
| PSA | 46.61000 |
| LogP | 1.21250 |
| Index of Refraction | 1.557 |
| InChIKey | FPIURKVYZFPGJO-UHFFFAOYSA-N |
| SMILES | CC(=O)OCC(=O)N(C)c1ccccc1 |
|
~%
2-(methylphenyl... CAS#:73251-32-8 |
| Literature: Bayer Aktiengesellschaft Patent: US4509971 A1, 1985 ; |
|
~%
2-(methylphenyl... CAS#:73251-32-8 |
| Literature: Miller, Marc; Vogel, Johannes C.; Tsang, William; Merrit, Andrew; Procter, David J. Organic and Biomolecular Chemistry, 2009 , vol. 7, # 3 p. 589 - 597 |
| N-Methyl-2-acetoxyacetanilide |
| EINECS 277-329-3 |
| 2-(Methylphenylamino)-2-oxoethyl acetate |
| Acetamide,2-(acetyloxy)-N-methyl-N-phenyl |
| acetoxy-N-methylacetanilide |