NCGC 607 structure
|
Common Name | NCGC 607 | ||
|---|---|---|---|---|
| CAS Number | 1462267-07-7 | Molecular Weight | 543.354 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 734.5±60.0 °C at 760 mmHg | |
| Molecular Formula | C24H22IN3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 398.0±32.9 °C | |
Use of NCGC 607NCGC607 is a noninhibitory chaperone of glucocerebrosidase (Gcase)[1]. |
| Name | NCGC607 |
|---|---|
| Synonym | More Synonyms |
| Description | NCGC607 is a noninhibitory chaperone of glucocerebrosidase (Gcase)[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 734.5±60.0 °C at 760 mmHg |
| Molecular Formula | C24H22IN3O4 |
| Molecular Weight | 543.354 |
| Flash Point | 398.0±32.9 °C |
| Exact Mass | 543.065491 |
| LogP | 3.90 |
| Vapour Pressure | 0.0±2.4 mmHg at 25°C |
| Index of Refraction | 1.679 |
| InChIKey | HFVDMJQQAKLUSN-UHFFFAOYSA-N |
| SMILES | CN(C(=O)CNC(=O)c1ccccc1OCC(=O)Nc1ccc(I)cc1)c1ccccc1 |
| Benzamide, 2-[2-[(4-iodophenyl)amino]-2-oxoethoxy]-N-[2-(methylphenylamino)-2-oxoethyl]- |
| 2-{2-[(4-Iodophenyl)amino]-2-oxoethoxy}-N-{2-[methyl(phenyl)amino]-2-oxoethyl}benzamide |
| NCGC607 |