GI-530159 structure
|
Common Name | GI-530159 | ||
|---|---|---|---|---|
| CAS Number | 69563-88-8 | Molecular Weight | 518.450 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 544.8±50.0 °C at 760 mmHg | |
| Molecular Formula | C27H20F6N2O2 | Melting Point | 159-163 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 283.3±30.1 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
Use of GI-530159GI-530159 is a selective, mechanosensitive opener of TREK1 (K2P2.1) and TREK2 (K2P10.1) channels, with an EC50 of 0.76 μM for TREK1. GI-530159 displays selectivity for TREK1/2 over TRAAK, TASK3 and other potassium channels. GI-530159 reduces rat dorsal root ganglion neuron excitability[1]. |
| Name | 2,2-bis[4-(4-aminophenoxy)phenyl]hexafluoropropane |
|---|---|
| Synonym | More Synonyms |
| Description | GI-530159 is a selective, mechanosensitive opener of TREK1 (K2P2.1) and TREK2 (K2P10.1) channels, with an EC50 of 0.76 μM for TREK1. GI-530159 displays selectivity for TREK1/2 over TRAAK, TASK3 and other potassium channels. GI-530159 reduces rat dorsal root ganglion neuron excitability[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 544.8±50.0 °C at 760 mmHg |
| Melting Point | 159-163 °C(lit.) |
| Molecular Formula | C27H20F6N2O2 |
| Molecular Weight | 518.450 |
| Flash Point | 283.3±30.1 °C |
| Exact Mass | 518.142883 |
| PSA | 70.50000 |
| LogP | 4.57 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
| Index of Refraction | 1.579 |
| InChIKey | HHLMWQDRYZAENA-UHFFFAOYSA-N |
| SMILES | Nc1ccc(Oc2ccc(C(c3ccc(Oc4ccc(N)cc4)cc3)(C(F)(F)F)C(F)(F)F)cc2)cc1 |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xn:Harmful; |
| Risk Phrases | R22;R36/37/38 |
| Safety Phrases | S26-S36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| RTECS | CY1213000 |
| HS Code | 2922299090 |
| HS Code | 2922299090 |
|---|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2,2-bis(4-[4-aminophenoxy]phenyl)hexafluoropropane |
| 2,2-bis[4-(p-aminophenoxy)phenyl]hexafluoropropane |
| 4,4'-[(1,1,1,3,3,3-Hexafluoro-2,2-propanediyl)bis(4,1-phenyleneoxy)]dianiline |
| 2,2-bis[4-(4'-aminophenoxy)phenyl]-1,1,1,3,3,3-hexafluoropropane |
| Benzenamine, 4,4'-[[2,2,2-trifluoro-1-(trifluoromethyl)ethylidene]bis(4,1-phenyleneoxy)]bis- |
| 2,2-bis[4-(4-aminophenoxy)-phenyl]hexafluoropropane |
| 4,4'-[(1,1,1,3,3,3-hexafluoropropane-2,2-diyl)bis(benzene-4,1-diyloxy)]dianiline |
| HFBAPP |
| MFCD00015723 |
| [1,1-bis(trifluoromethyl)-1,1-bis(4-(4-amino-phenoxy)-phenyl)]methane |
| 1,1,1,3,3,3-hexafluoro-2,2-bis[4-(4-aminophenoxy)phenyl]propane |
| isbenzenamine |
| 2,2'-BIS[4-(4-AMINOPHENOXY)PHENY]HEXAFLUOROPROPANE |
| BAPOFP |
| BIS-AF-A |
| 4-BDAF |
| leneoxy))bis |
| 4',4'''-(Hexafluoroisopropylidene)-bis-(4-phenoxyaniline) |
| 4,4'-[(1,1,1,3,3,3-Hexafluoropropane-2,2-diyl)bis(4,1-phenyleneoxy)]dianiline |
| 2,2-BIS[4-(4-AMINOPH |