3-(4-fluorophenyl)-1-(1,3-thiazol-2-yl)urea structure
|
Common Name | 3-(4-fluorophenyl)-1-(1,3-thiazol-2-yl)urea | ||
|---|---|---|---|---|
| CAS Number | 69123-56-4 | Molecular Weight | 237.25300 | |
| Density | 1.513g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C10H8FN3OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(4-fluorophenyl)-3-(1,3-thiazol-2-yl)urea |
|---|
| Density | 1.513g/cm3 |
|---|---|
| Molecular Formula | C10H8FN3OS |
| Molecular Weight | 237.25300 |
| Exact Mass | 237.03700 |
| PSA | 82.26000 |
| LogP | 3.07220 |
| Index of Refraction | 1.714 |
| InChIKey | FLRRKLSSERTNQH-UHFFFAOYSA-N |
| SMILES | O=C(Nc1ccc(F)cc1)Nc1nccs1 |
|
~71%
3-(4-fluorophen... CAS#:69123-56-4 |
| Literature: Walchshofer; Minjat; Tinland; et al. European Journal of Medicinal Chemistry, 1986 , vol. 21, # 1 p. 59 - 64 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |