3-(4-chlorophenyl)-1-(1,3-thiazol-2-yl)urea structure
|
Common Name | 3-(4-chlorophenyl)-1-(1,3-thiazol-2-yl)urea | ||
|---|---|---|---|---|
| CAS Number | 69123-55-3 | Molecular Weight | 253.70800 | |
| Density | 1.542g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C10H8ClN3OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(4-chlorophenyl)-3-(1,3-thiazol-2-yl)urea |
|---|---|
| Synonym | More Synonyms |
| Density | 1.542g/cm3 |
|---|---|
| Molecular Formula | C10H8ClN3OS |
| Molecular Weight | 253.70800 |
| Exact Mass | 253.00800 |
| PSA | 82.26000 |
| LogP | 3.58650 |
| Index of Refraction | 1.741 |
| InChIKey | KPRKVTCHPGWYQW-UHFFFAOYSA-N |
| SMILES | O=C(Nc1ccc(Cl)cc1)Nc1nccs1 |
|
~82%
3-(4-chlorophen... CAS#:69123-55-3 |
| Literature: Walchshofer; Minjat; Tinland; et al. European Journal of Medicinal Chemistry, 1986 , vol. 21, # 1 p. 59 - 64 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HMS2361F10 |
| 1-(4-chloro-phenyl)-3-thiazol-2-yl-urea |