Fentin chloride structure
|
Common Name | Fentin chloride | ||
|---|---|---|---|---|
| CAS Number | 639-58-7 | Molecular Weight | 385.475 | |
| Density | 1.49 g/cm3 (20ºC) | Boiling Point | 397.1±0.0 °C at 760 mmHg | |
| Molecular Formula | C18H15ClSn | Melting Point | 108 °C (dec.)(lit.) | |
| MSDS | Chinese USA | Flash Point | 199.7±24.0 °C | |
| Symbol |
GHS05, GHS06, GHS09 |
Signal Word | Danger | |
| Name | fentin chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.49 g/cm3 (20ºC) |
|---|---|
| Boiling Point | 397.1±0.0 °C at 760 mmHg |
| Melting Point | 108 °C (dec.)(lit.) |
| Molecular Formula | C18H15ClSn |
| Molecular Weight | 385.475 |
| Flash Point | 199.7±24.0 °C |
| Exact Mass | 385.988434 |
| LogP | 3.56 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| InChIKey | NJVOZLGKTAPUTQ-UHFFFAOYSA-M |
| SMILES | Cl[Sn](c1ccccc1)(c1ccccc1)c1ccccc1 |
| Storage condition | APPROX 4°C |
| Water Solubility | insoluble |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
MUTATION DATA
|
| Symbol |
GHS05, GHS06, GHS09 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H301 + H311 + H331-H315-H318-H410 |
| Precautionary Statements | P261-P280-P301 + P310 + P330-P305 + P351 + P338 + P310-P403 + P233 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Faceshields;full-face particle respirator type N100 (US);Gloves;respirator cartridge type N100 (US);type P1 (EN143) respirator filter;type P2 (EN 143) respirator cartridges;type P3 (EN 143) respirator cartridges |
| Hazard Codes | T: Toxic;N: Dangerous for the environment; |
| Risk Phrases | R23/24/25;R50/53 |
| Safety Phrases | S26-S27-S28-S45-S60-S61-S28A-S36/37/39 |
| RIDADR | UN 3146 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | WH6860000 |
| Packaging Group | III |
| Hazard Class | 6.1 |
| HS Code | 29310095 |
| Precursor 10 | |
|---|---|
| DownStream 10 | |
| HS Code | 2931900046 |
|---|---|
| Summary | 2931900046 chlorotriphenylstannane。supervision conditions:s(import or export registration certificate for pesticides)。VAT:17.0%。tax rebate rate:9.0%。MFN tarrif:6.5%。general tariff:30.0% |
|
Synthesis, characterization and biocidal activity of new organotin complexes of 2-(3-oxocyclohex-1-enyl)benzoic acid.
Eur. J. Med. Chem. 45 , 883-9, (2010) The reaction of 1,3-cyclohexadione with 2-aminobenzoic acid has produced the 2-(3-oxocyclohex-1-enyl)benzoic acid (HOBz). Subsequent reactions of the ligand with organotin chlorides led to [Me(2)Sn(OB... |
|
|
Modifications of erythrocyte membrane hydration induced by organic tin compounds.
Cell Biol. Int. 33(7) , 801-6, (2009) A study on the effects of selected organic chlorides of tin on the extent of hydration of the lipid bilayer of erythrocyte ghosts from pig blood is presented. The following compounds were used, dibuty... |
|
|
Larvicidal activities of some organotin compounds on mosquito larvae: A QSAR study
Eur. J. Med. Chem. 44 , 260-73, (2009) Mosquitoes are not only the cause of nuisance by their bites but also transmit deadly diseases like malaria, filariasis, yellow fever, dengue, and Japanese encephalitis. In this paper, nine QSAR model... |
| Chloro(triphenyl)stannane |
| Stannane, chlorotriphenyl- |
| Triphenylstannylium chloride |
| chlorotriphenylstannane |
| Fentin chloride [ISO] |
| Chlorotriphenyltin |
| Fentin chloride |
| triphenylchlorotin |
| TRIPHENYLCHLOROSTANNANE |
| MFCD01861652 |
| triphenyltin chloride |
| EINECS 211-358-4 |