Dimethyl 2,5-dioxocyclohexane-1,4-dicarboxylate structure
|
Common Name | Dimethyl 2,5-dioxocyclohexane-1,4-dicarboxylate | ||
|---|---|---|---|---|
| CAS Number | 6289-46-9 | Molecular Weight | 228.199 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 350.5±42.0 °C at 760 mmHg | |
| Molecular Formula | C10H12O6 | Melting Point | 154-157 °C | |
| MSDS | N/A | Flash Point | 156.1±27.9 °C | |
| Name | Dimethyl 1,4-cyclohexanedione-2,5-dicarboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 350.5±42.0 °C at 760 mmHg |
| Melting Point | 154-157 °C |
| Molecular Formula | C10H12O6 |
| Molecular Weight | 228.199 |
| Flash Point | 156.1±27.9 °C |
| Exact Mass | 228.063385 |
| PSA | 86.74000 |
| LogP | -0.23 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.482 |
| InChIKey | MHKKFFHWMKEBDW-UHFFFAOYSA-N |
| SMILES | COC(=O)C1CC(=O)C(C(=O)OC)CC1=O |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | S37/39-S26-S24/25 |
| WGK Germany | 1 |
| HS Code | 2918300090 |
|
~66%
Dimethyl 2,5-di... CAS#:6289-46-9 |
| Literature: Seebach, Dieter; Hoffmann, Torsten; Kuehnle, Florian N. M.; Kinkel, Joachim N.; Schulte, Michael Helvetica Chimica Acta, 1995 , vol. 78, # 6 p. 1525 - 1540 |
|
~%
Dimethyl 2,5-di... CAS#:6289-46-9 |
| Literature: Asian Journal of Chemistry, , vol. 25, # 3 p. 1349 - 1352 |
|
~%
Dimethyl 2,5-di... CAS#:6289-46-9 |
| Literature: Asian Journal of Chemistry, , vol. 25, # 3 p. 1349 - 1352 |
|
~%
Dimethyl 2,5-di... CAS#:6289-46-9 |
| Literature: Justus Liebigs Annalen der Chemie, , vol. 404, p. 299 |
|
~%
Detail
|
| Literature: Monatshefte fuer Chemie, , vol. 32, p. 77 |
| Precursor 7 | |
|---|---|
| DownStream 10 | |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| Dimethyl succinyl succinate |
| 1,4-Cyclohexanedicarboxylic acid, 2,5-dioxo-, dimethyl ester |
| MFCD00001607 |
| dimethyl 2,5-dioxocyclohexane-1,4-dicarboxylate |
| EINECS 228-528-9 |
| Dimethyl 2,5-dioxo-1,4-cyclohexanedicarboxylate |