Diethyl succinosuccinate structure
|
Common Name | Diethyl succinosuccinate | ||
|---|---|---|---|---|
| CAS Number | 787-07-5 | Molecular Weight | 256.25200 | |
| Density | 1.233g/cm3 | Boiling Point | 375.7ºC at 760mmHg | |
| Molecular Formula | C12H16O6 | Melting Point | 127-129 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 166.4ºC | |
| Name | diethyl 2,5-dioxocyclohexane-1,4-dicarboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.233g/cm3 |
|---|---|
| Boiling Point | 375.7ºC at 760mmHg |
| Melting Point | 127-129 °C(lit.) |
| Molecular Formula | C12H16O6 |
| Molecular Weight | 256.25200 |
| Flash Point | 166.4ºC |
| Exact Mass | 256.09500 |
| PSA | 86.74000 |
| LogP | 0.27700 |
| Index of Refraction | 1.48 |
| InChIKey | KSKWGMNRWCYVAT-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1CC(=O)C(C(=O)OCC)CC1=O |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2918300090 |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|
Poly (amine esters) Derived from Diethyl 1, 4-Cyclohexanedione-2, 5-dicarboxylate. Moore JA and Kochanowski JE.
Macromolecules 8(2) , 121-127, (1975)
|
| MFCD00001608 |
| Diethyl succinylsuccinate |
| EINECS 212-327-8 |
| Diethyl 1,5-dicarboxylate |
| Diethyl succinosuccinate |
| diethyl 1,4-cyclohexanedione-2,5-dicarboxylate |
| 2,4 cyclohexanedione |
| diethyl 2,5-dioxo-1,4-cyclohexanedicarboxylate |
| 2,5-Dicarbethoxy-1,4-cyclohexanedione |
| diethyl 2,5-cyclohexanedione-1,4-dicarboxylate |
| 2,5-diethylformate 1,4-cyclohexanedione |
| Succinylsuccinic acid ethyl ester |
| Diethyl succinylo succinate |