1-METHYLPIPERIDIN-4-YL 2,2-DIPHENYL-2-PROPOXYACETATE structure
|
Common Name | 1-METHYLPIPERIDIN-4-YL 2,2-DIPHENYL-2-PROPOXYACETATE | ||
|---|---|---|---|---|
| CAS Number | 60569-19-9 | Molecular Weight | 367.48 | |
| Density | 1.08 g/cm3 | Boiling Point | 468.8ºC at 760 mmHg | |
| Molecular Formula | C23H29NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 134.6ºC | |
Use of 1-METHYLPIPERIDIN-4-YL 2,2-DIPHENYL-2-PROPOXYACETATEPropiverine is a potent antimuscarinic agent. Propiverine inhibits cellular calcium influx, thereby diminishing muscle spasm. Propiverine has neurotropic and musculotropic effects on the urinary bladder smooth muscle. Propiverine can used for overactive bladder (OAB) research[1][2]. |
| Name | (1-Methyl-4-piperidyl) 2,2-diphenyl-2-propoxy-acetate |
|---|---|
| Synonym | More Synonyms |
| Description | Propiverine is a potent antimuscarinic agent. Propiverine inhibits cellular calcium influx, thereby diminishing muscle spasm. Propiverine has neurotropic and musculotropic effects on the urinary bladder smooth muscle. Propiverine can used for overactive bladder (OAB) research[1][2]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.08 g/cm3 |
|---|---|
| Boiling Point | 468.8ºC at 760 mmHg |
| Molecular Formula | C23H29NO3 |
| Molecular Weight | 367.48 |
| Flash Point | 134.6ºC |
| Exact Mass | 367.21500 |
| PSA | 38.77000 |
| LogP | 3.93210 |
| Index of Refraction | 1.57 |
| InChIKey | QPCVHQBVMYCJOM-UHFFFAOYSA-N |
| SMILES | CCCOC(C(=O)OC1CCN(C)CC1)(c1ccccc1)c1ccccc1 |
| HS Code | 2933399090 |
|---|
|
~%
1-METHYLPIPERID... CAS#:60569-19-9 |
| Literature: WO2014/39627 A1, ; Page/Page column 126 ; |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Propiverine |