NSC 745887
Modify Date: 2025-08-26 23:56:50
NSC 745887 structure
|
Common Name | NSC 745887 | ||
|---|---|---|---|---|
| CAS Number | 54490-26-5 | Molecular Weight | 260.25 | |
| Density | 1.448±0.06 g/cm3(Predicted) | Boiling Point | 491.6±40.0 °C(Predicted) | |
| Molecular Formula | C16H8N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of NSC 745887NSC745887 (compound 25) is an anti-cancer agent. NSC745887 exhibits dose-dependent inhibition of proliferation in all 60 cancer cell lines[1]. |
| Name | nsc745887 |
|---|---|
| Synonym | More Synonyms |
| Description | NSC745887 (compound 25) is an anti-cancer agent. NSC745887 exhibits dose-dependent inhibition of proliferation in all 60 cancer cell lines[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.448±0.06 g/cm3(Predicted) |
|---|---|
| Boiling Point | 491.6±40.0 °C(Predicted) |
| Molecular Formula | C16H8N2O2 |
| Molecular Weight | 260.25 |
| Exact Mass | 260.05900 |
| PSA | 59.92000 |
| LogP | 2.40520 |
| InChIKey | DGLSEJAACVWJNU-UHFFFAOYSA-N |
| SMILES | O=C1c2ccccc2C(=O)c2c1ccc1nccnc21 |
| Storage condition | -20°C |
| Hazard Codes | Xn |
|---|
| naphtho<2,3-f>quinoxaline-7,12-dione |
| naphtho[2,3-f]quinoxaline-7,12-dione |
| 1,4-Diaza-benzo[a]anthracene-7,12-dione |
| Naphtho<2,3-f>chinoxalin-7,12-dion |
| 7,12-dioxo-7,12-dihydroanthra[1,2-b]pyrazine |