2-((4-Chlorophenyl)acetyl)benzoic acid structure
|
Common Name | 2-((4-Chlorophenyl)acetyl)benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 53242-76-5 | Molecular Weight | 274.69900 | |
| Density | 1.332 g/cm3 | Boiling Point | 456.8ºC at 760 mmHg | |
| Molecular Formula | C15H11ClO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 230.1ºC | |
| Name | 2-(2-(4-Chlorophenyl)acetyl)benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.332 g/cm3 |
|---|---|
| Boiling Point | 456.8ºC at 760 mmHg |
| Molecular Formula | C15H11ClO3 |
| Molecular Weight | 274.69900 |
| Flash Point | 230.1ºC |
| Exact Mass | 274.04000 |
| PSA | 54.37000 |
| LogP | 3.46360 |
| Index of Refraction | 1.621 |
| InChIKey | BDSINYHJZLINDJ-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccccc1C(=O)Cc1ccc(Cl)cc1 |
| Hazard Codes | Xn |
|---|---|
| HS Code | 2918300090 |
|
~%
2-((4-Chlorophe... CAS#:53242-76-5 |
| Literature: Organic Letters, , vol. 11, # 20 p. 4712 - 4715 |
|
~%
2-((4-Chlorophe... CAS#:53242-76-5 |
| Literature: Archiv der Pharmazie, , vol. 321, # 4 p. 205 - 208 |
|
~%
2-((4-Chlorophe... CAS#:53242-76-5 |
| Literature: Archiv der Pharmazie, , vol. 321, # 4 p. 205 - 208 |
|
~%
2-((4-Chlorophe... CAS#:53242-76-5 |
| Literature: Archiv der Pharmazie, , vol. 321, # 4 p. 205 - 208 |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| EINECS 258-444-8 |
| MFCD07369702 |
| 2-((4-Chlorophenyl)acetyl)benzoic acid |
| Azelastine Impurity 5 |