4-chlorobenzylidene phthalide structure
|
Common Name | 4-chlorobenzylidene phthalide | ||
|---|---|---|---|---|
| CAS Number | 20526-97-0 | Molecular Weight | 256.68400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H9ClO2 | Melting Point | 153.0 to 158.0 °C | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-((4-Chlorophenyl)methylene)phthalide |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 153.0 to 158.0 °C |
|---|---|
| Molecular Formula | C15H9ClO2 |
| Molecular Weight | 256.68400 |
| Exact Mass | 256.02900 |
| PSA | 26.30000 |
| LogP | 4.00850 |
| Vapour Pressure | 6.76E-07mmHg at 25°C |
| InChIKey | OHRFHJYUEWVXBD-UHFFFAOYSA-N |
| SMILES | O=C1OC(=Cc2ccc(Cl)cc2)c2ccccc21 |
| RIDADR | NONH for all modes of transport |
|---|---|
| HS Code | 2932209090 |
|
~63%
4-chlorobenzyli... CAS#:20526-97-0 |
| Literature: Havaldar, Freddy H.; Dabholkar, Bhushan V.; Mule, Ganesh B. Synthetic Communications, 2013 , vol. 43, # 8 p. 1127 - 1137 |
| HS Code | 2932209090 |
|---|---|
| Summary | 2932209090. other lactones. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-(p-Chlorobenzylidene)phthalide |
| 3-[(4-chlorophenyl)methylene]phthalide |
| 3-(4-chlorobenzylidene)pentane-2,4-dione |
| 3-(4-chlorobenzylidene)-2-benzofuran-1(3H)-one |
| Azelastine impurity E |
| 3-(4-Chlorobenzylidene)-2,4-pentanedione |
| 1-Oxo-3-(4-chlor-benzyliden)-phthalan |
| 3-(4-chloro-benzylidene)-3H-isobenzofuran-1-one |
| 3-(p-chlorobenzylidene)-2,4-pentandione |